C20H32O2 — CID 162922719
(1S,3R,6S,7S,10R,11S,14R)-3,10,14-trimethyl-6-propan-2-yl-15-oxatetracyclo[9.3.1.01,11.03,7]pentadecan-13-one (PubChem CID 162922719) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3R,6S,7S,10R,11S,14R)-3,10,14-trimethyl-6-propan-2-yl-15-oxatetracyclo[9.3.1.01,11.03,7]pentadecan-13-one.
| Compound Name | (1S,3R,6S,7S,10R,11S,14R)-3,10,14-trimethyl-6-propan-2-yl-15-oxatetracyclo[9.3.1.01,11.03,7]pentadecan-13-one |
|---|---|
| PubChem CID | 162922719 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3R,6S,7S,10R,11S,14R)-3,10,14-trimethyl-6-propan-2-yl-15-oxatetracyclo[9.3.1.01,11.03,7]pentadecan-13-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)C[C@@]34O[C@@]3(CC(=O)[C@@H]4C)[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-12(2)15-8-9-18(5)11-20-14(4)17(21)10-19(20,22-20)13(3)6-7-16(15)18/h12-16H,6-11H2,1-5H3/t13-,14+,15+,16+,18-,19+,20+/m1/s1 |
| InChIKey | JRGGMWWVJVRZMW-KWTCDADXSA-N |
| XLogP | 4.61 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|