C20H32O2 — CID 11822870
(1R,3R,6R,7S,10S,11S,13S,15R)-3,10,15-trimethyl-6-propan-2-yl-12,16-dioxapentacyclo[9.5.0.01,15.03,7.011,13]hexadecane (PubChem CID 11822870) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,3R,6R,7S,10S,11S,13S,15R)-3,10,15-trimethyl-6-propan-2-yl-12,16-dioxapentacyclo[9.5.0.01,15.03,7.011,13]hexadecane.
| Compound Name | (1R,3R,6R,7S,10S,11S,13S,15R)-3,10,15-trimethyl-6-propan-2-yl-12,16-dioxapentacyclo[9.5.0.01,15.03,7.011,13]hexadecane |
|---|---|
| PubChem CID | 11822870 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,3R,6R,7S,10S,11S,13S,15R)-3,10,15-trimethyl-6-propan-2-yl-12,16-dioxapentacyclo[9.5.0.01,15.03,7.011,13]hexadecane |
| SMILES | CC(C)[C@H]1CC[C@]2(C)C[C@@]34O[C@]3(C)C[C@@H]3O[C@@]34[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-12(2)14-8-9-17(4)11-19-18(5,22-19)10-16-20(19,21-16)13(3)6-7-15(14)17/h12-16H,6-11H2,1-5H3/t13-,14+,15-,16-,17+,18+,19+,20-/m0/s1 |
| InChIKey | IVJBQLORQCAWPC-VKCHCZRYSA-N |
| XLogP | 4.56 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|