C19H26OSe — CID 10089160
(3S,3aS,7aR)-7a-methyl-6-phenylselanyl-3-propan-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 10089160) has the molecular formula C19H26OSe and a molecular weight of 349.38 g/mol. Its IUPAC name is (3S,3aS,7aR)-7a-methyl-6-phenylselanyl-3-propan-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (3S,3aS,7aR)-7a-methyl-6-phenylselanyl-3-propan-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 10089160 |
| Molecular Formula | C19H26OSe |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (3S,3aS,7aR)-7a-methyl-6-phenylselanyl-3-propan-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)CC([Se]c3ccccc3)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C19H26OSe/c1-13(2)15-9-10-19(3)12-18(17(20)11-16(15)19)21-14-7-5-4-6-8-14/h4-8,13,15-16,18H,9-12H2,1-3H3/t15-,16-,18?,19+/m0/s1 |
| InChIKey | HHLRDPFVEZOYAX-PGZWAEKXSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|