C31H30O5S — CID 163359681
[(E,2S)-7-(benzenesulfonyl)-2-(6-methoxynaphthalen-2-yl)hept-5-en-3-yl] benzoate (PubChem CID 163359681) has the molecular formula C31H30O5S and a molecular weight of 514.64 g/mol. Its IUPAC name is [(E,2S)-7-(benzenesulfonyl)-2-(6-methoxynaphthalen-2-yl)hept-5-en-3-yl] benzoate.
| Compound Name | [(E,2S)-7-(benzenesulfonyl)-2-(6-methoxynaphthalen-2-yl)hept-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 163359681 |
| Molecular Formula | C31H30O5S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | [(E,2S)-7-(benzenesulfonyl)-2-(6-methoxynaphthalen-2-yl)hept-5-en-3-yl] benzoate |
| SMILES | COc1ccc2cc([C@H](C)C(C/C=C/CS(=O)(=O)c3ccccc3)OC(=O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C31H30O5S/c1-23(25-16-17-27-22-28(35-2)19-18-26(27)21-25)30(36-31(32)24-11-5-3-6-12-24)15-9-10-20-37(33,34)29-13-7-4-8-14-29/h3-14,16-19,21-23,30H,15,20H2,1-2H3/b10-9+/t23-,30?/m0/s1 |
| InChIKey | SVOPQYQJNDLHLE-QQWLFLJRSA-N |
| XLogP | 6.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|