C28H25NO6S — CID 163359653
[(E)-7-(benzenesulfonyl)-1-(1,3-dioxoisoindol-2-yl)hept-5-en-3-yl] benzoate (PubChem CID 163359653) has the molecular formula C28H25NO6S and a molecular weight of 503.58 g/mol. Its IUPAC name is [(E)-7-(benzenesulfonyl)-1-(1,3-dioxoisoindol-2-yl)hept-5-en-3-yl] benzoate.
| Compound Name | [(E)-7-(benzenesulfonyl)-1-(1,3-dioxoisoindol-2-yl)hept-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 163359653 |
| Molecular Formula | C28H25NO6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [(E)-7-(benzenesulfonyl)-1-(1,3-dioxoisoindol-2-yl)hept-5-en-3-yl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccccc1)CCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C28H25NO6S/c30-26-24-16-7-8-17-25(24)27(31)29(26)19-18-22(35-28(32)21-11-3-1-4-12-21)13-9-10-20-36(33,34)23-14-5-2-6-15-23/h1-12,14-17,22H,13,18-20H2/b10-9+ |
| InChIKey | HTYAADQZGYSYJM-MDZDMXLPSA-N |
| XLogP | 4.32 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|