C25H25NO6 — CID 101186079
[10-(1,3-dioxoisoindol-2-yl)-2,6-dioxodecan-5-yl] benzoate (PubChem CID 101186079) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is [10-(1,3-dioxoisoindol-2-yl)-2,6-dioxodecan-5-yl] benzoate.
| Compound Name | [10-(1,3-dioxoisoindol-2-yl)-2,6-dioxodecan-5-yl] benzoate |
|---|---|
| PubChem CID | 101186079 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [10-(1,3-dioxoisoindol-2-yl)-2,6-dioxodecan-5-yl] benzoate |
| SMILES | CC(=O)CCC(OC(=O)c1ccccc1)C(=O)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H25NO6/c1-17(27)14-15-22(32-25(31)18-9-3-2-4-10-18)21(28)13-7-8-16-26-23(29)19-11-5-6-12-20(19)24(26)30/h2-6,9-12,22H,7-8,13-16H2,1H3 |
| InChIKey | GPOMWULOZHNREH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|