C20H15NO5 — CID 101466449
[5-(1,3-dioxoisoindol-2-yl)-3-oxopent-1-en-2-yl] benzoate (PubChem CID 101466449) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is [5-(1,3-dioxoisoindol-2-yl)-3-oxopent-1-en-2-yl] benzoate.
| Compound Name | [5-(1,3-dioxoisoindol-2-yl)-3-oxopent-1-en-2-yl] benzoate |
|---|---|
| PubChem CID | 101466449 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [5-(1,3-dioxoisoindol-2-yl)-3-oxopent-1-en-2-yl] benzoate |
| SMILES | C=C(OC(=O)c1ccccc1)C(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H15NO5/c1-13(26-20(25)14-7-3-2-4-8-14)17(22)11-12-21-18(23)15-9-5-6-10-16(15)19(21)24/h2-10H,1,11-12H2 |
| InChIKey | XJZKDSUVOGHHIH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|