C20H17NO4 — CID 42632109
[(E)-3-phenylprop-2-enyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 42632109) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 42632109 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H17NO4/c22-18(25-14-6-9-15-7-2-1-3-8-15)12-13-21-19(23)16-10-4-5-11-17(16)20(21)24/h1-11H,12-14H2/b9-6+ |
| InChIKey | XZYCUZQXPSNIRA-RMKNXTFCSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|