C21H24N2O4S — CID 164666030
2-[(3R)-5-(benzenesulfonyl)-3-(dimethylamino)pentyl]isoindole-1,3-dione (PubChem CID 164666030) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[(3R)-5-(benzenesulfonyl)-3-(dimethylamino)pentyl]isoindole-1,3-dione.
| Compound Name | 2-[(3R)-5-(benzenesulfonyl)-3-(dimethylamino)pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164666030 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[(3R)-5-(benzenesulfonyl)-3-(dimethylamino)pentyl]isoindole-1,3-dione |
| SMILES | CN(C)[C@H](CCN1C(=O)c2ccccc2C1=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-22(2)16(13-15-28(26,27)17-8-4-3-5-9-17)12-14-23-20(24)18-10-6-7-11-19(18)21(23)25/h3-11,16H,12-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | JLNGKFHRLIZLIQ-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|