C17H21N5O2S — CID 163361151
5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]pentane-1,2-diol (PubChem CID 163361151) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]pentane-1,2-diol.
| Compound Name | 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]pentane-1,2-diol |
|---|---|
| PubChem CID | 163361151 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]pentane-1,2-diol |
| SMILES | Cc1cc(NCCCC(O)CO)nnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H21N5O2S/c1-11-9-15(18-8-4-5-12(24)10-23)21-22-16(11)20-17-19-13-6-2-3-7-14(13)25-17/h2-3,6-7,9,12,23-24H,4-5,8,10H2,1H3,(H,18,21)(H,19,20,22) |
| InChIKey | HKXZVVHBODWTIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|