C20H29ClN2S — CID 163368827
3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione;chloromethane;ethane (PubChem CID 163368827) has the molecular formula C20H29ClN2S and a molecular weight of 364.99 g/mol. Its IUPAC name is 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione;chloromethane;ethane.
| Compound Name | 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione;chloromethane;ethane |
|---|---|
| PubChem CID | 163368827 |
| Molecular Formula | C20H29ClN2S |
| Molecular Weight | 364.99 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione;chloromethane;ethane |
| SMILES | C=C/C=C\C(=C/C)c1cn(C(/C=C\C=C)=C/C)c(=S)[nH]1.CC.CCl |
| InChI | InChI=1S/C17H20N2S.C2H6.CH3Cl/c1-5-9-11-14(7-3)16-13-19(17(20)18-16)15(8-4)12-10-6-2;2*1-2/h5-13H,1-2H2,3-4H3,(H,18,20);1-2H3;1H3/b11-9-,12-10-,14-7+,15-8+;; |
| InChIKey | MJJRKTGDFZXHMF-MVCYOFFTSA-N |
| XLogP | 7.18 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.99 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|