About 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione
3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione (PubChem CID 163369716) has the molecular formula C23H23F2N3O3
and a molecular weight of 427.45 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione |
| PubChem CID | 163369716 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(F)c(O)c(F)c2)C(=O)N1CCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23F2N3O3/c24-18-12-16(13-19(25)22(18)30)26-20-14-21(29)28(23(20)31)11-8-15-4-6-17(7-5-15)27-9-2-1-3-10-27/h4-7,12-14,26,30H,1-3,8-11H2 |
| InChIKey | YWOXBMPSWWUDGW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione?
The IUPAC name of 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione (CID 163369716) is 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione.
What is the SMILES notation for 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione?
The canonical SMILES for 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione is O=C1C=C(Nc2cc(F)c(O)c(F)c2)C(=O)N1CCc1ccc(N2CCCCC2)cc1.
What is the InChIKey of 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione?
The InChIKey is YWOXBMPSWWUDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F2N3O3/c24-18-12-16(13-19(25)22(18)30)26-20-14-21(29)28(23(20)31)11-8-15-4-6-17(7-5-15)27-9-2-1-3-10-27/h4-7,12-14,26,30H,1-3,8-11H2.
What are the key properties of 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione?
3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione has a molecular weight of 427.45 g/mol, XLogP of 3.57, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluoro-4-hydroxyanilino)-1-[2-(4-piperidin-1-ylphenyl)ethyl]pyrrole-2,5-dione is sourced from PubChem (CID 163369716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).