C17H10F2N2O5 — CID 163369714
1-(1,3-benzodioxol-5-yl)-3-(3,5-difluoro-4-hydroxyanilino)pyrrole-2,5-dione (PubChem CID 163369714) has the molecular formula C17H10F2N2O5 and a molecular weight of 360.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3,5-difluoro-4-hydroxyanilino)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3,5-difluoro-4-hydroxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163369714 |
| Molecular Formula | C17H10F2N2O5 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3,5-difluoro-4-hydroxyanilino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(F)c(O)c(F)c2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H10F2N2O5/c18-10-3-8(4-11(19)16(10)23)20-12-6-15(22)21(17(12)24)9-1-2-13-14(5-9)26-7-25-13/h1-6,20,23H,7H2 |
| InChIKey | CTTANAWRTCOFAG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|