C17H10F4N2O4 — CID 163369605
3-(3,5-difluoro-4-hydroxyanilino)-1-[4-(difluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 163369605) has the molecular formula C17H10F4N2O4 and a molecular weight of 382.27 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-hydroxyanilino)-1-[4-(difluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[4-(difluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163369605 |
| Molecular Formula | C17H10F4N2O4 |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[4-(difluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(F)c(O)c(F)c2)C(=O)N1c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H10F4N2O4/c18-11-5-8(6-12(19)15(11)25)22-13-7-14(24)23(16(13)26)9-1-3-10(4-2-9)27-17(20)21/h1-7,17,22,25H |
| InChIKey | UJIBZFMULURYHG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|