C14H25NO2 — CID 163374134
4-ethyl-1-(3-methylazetidin-1-yl)octane-1,7-dione (PubChem CID 163374134) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-ethyl-1-(3-methylazetidin-1-yl)octane-1,7-dione.
| Compound Name | 4-ethyl-1-(3-methylazetidin-1-yl)octane-1,7-dione |
|---|---|
| PubChem CID | 163374134 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-ethyl-1-(3-methylazetidin-1-yl)octane-1,7-dione |
| SMILES | CCC(CCC(C)=O)CCC(=O)N1CC(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-4-13(6-5-12(3)16)7-8-14(17)15-9-11(2)10-15/h11,13H,4-10H2,1-3H3 |
| InChIKey | FWKMLOOELWRMGU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |