C29H39BN2O6S — CID 163384365
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-methoxy-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenyl]sulfonylurea (PubChem CID 163384365) has the molecular formula C29H39BN2O6S and a molecular weight of 554.52 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-methoxy-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenyl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-methoxy-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 163384365 |
| Molecular Formula | C29H39BN2O6S |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-methoxy-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenyl]sulfonylurea |
| SMILES | COc1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)ccc1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H39BN2O6S/c1-28(2)29(3,4)38-30(37-28)16-8-11-19-14-15-22(18-25(19)36-5)39(34,35)32-27(33)31-26-23-12-6-9-20(23)17-21-10-7-13-24(21)26/h14-15,17-18H,6-13,16H2,1-5H3,(H2,31,32,33) |
| InChIKey | WFCMNBKAFOHCAO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|