C20H33N5O8 — CID 163385146
ethenyl 2-[[2-[2-(2-acetyloxypropanoylamino)propanoylamino]-4-amino-4-oxobutanoyl]amino]-6-aminohexanoate (PubChem CID 163385146) has the molecular formula C20H33N5O8 and a molecular weight of 471.51 g/mol. Its IUPAC name is ethenyl 2-[[2-[2-(2-acetyloxypropanoylamino)propanoylamino]-4-amino-4-oxobutanoyl]amino]-6-aminohexanoate.
| Compound Name | ethenyl 2-[[2-[2-(2-acetyloxypropanoylamino)propanoylamino]-4-amino-4-oxobutanoyl]amino]-6-aminohexanoate |
|---|---|
| PubChem CID | 163385146 |
| Molecular Formula | C20H33N5O8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | ethenyl 2-[[2-[2-(2-acetyloxypropanoylamino)propanoylamino]-4-amino-4-oxobutanoyl]amino]-6-aminohexanoate |
| SMILES | C=COC(=O)C(CCCCN)NC(=O)C(CC(N)=O)NC(=O)C(C)NC(=O)C(C)OC(C)=O |
| InChI | InChI=1S/C20H33N5O8/c1-5-32-20(31)14(8-6-7-9-21)24-19(30)15(10-16(22)27)25-17(28)11(2)23-18(29)12(3)33-13(4)26/h5,11-12,14-15H,1,6-10,21H2,2-4H3,(H2,22,27)(H,23,29)(H,24,30)(H,25,28) |
| InChIKey | HUPQXSOYWCTAIJ-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 209.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|