C23H19F2N5O5 — CID 163385280
4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)-6-nitropyridazin-3-one (PubChem CID 163385280) has the molecular formula C23H19F2N5O5 and a molecular weight of 483.43 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)-6-nitropyridazin-3-one.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)-6-nitropyridazin-3-one |
|---|---|
| PubChem CID | 163385280 |
| Molecular Formula | C23H19F2N5O5 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)-6-nitropyridazin-3-one |
| SMILES | CCO/C=C/c1c([N+](=O)[O-])nn(-c2ccc3nn(C)cc3c2)c(=O)c1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H19F2N5O5/c1-3-34-11-10-18-20(14-4-7-17(8-5-14)35-23(24)25)22(31)29(27-21(18)30(32)33)16-6-9-19-15(12-16)13-28(2)26-19/h4-13,23H,3H2,1-2H3/b11-10+ |
| InChIKey | DOIUQJRULQCKOX-ZHACJKMWSA-N |
| XLogP | 4.30 |
| TPSA | 114.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|