C23H21F2N5O3 — CID 163385319
6-amino-4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)pyridazin-3-one (PubChem CID 163385319) has the molecular formula C23H21F2N5O3 and a molecular weight of 453.45 g/mol. Its IUPAC name is 6-amino-4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)pyridazin-3-one.
| Compound Name | 6-amino-4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 163385319 |
| Molecular Formula | C23H21F2N5O3 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 6-amino-4-[4-(difluoromethoxy)phenyl]-5-[(E)-2-ethoxyethenyl]-2-(2-methylindazol-5-yl)pyridazin-3-one |
| SMILES | CCO/C=C/c1c(N)nn(-c2ccc3nn(C)cc3c2)c(=O)c1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H21F2N5O3/c1-3-32-11-10-18-20(14-4-7-17(8-5-14)33-23(24)25)22(31)30(28-21(18)26)16-6-9-19-15(12-16)13-29(2)27-19/h4-13,23H,3H2,1-2H3,(H2,26,28)/b11-10+ |
| InChIKey | COQCXODQSGTIIU-ZHACJKMWSA-N |
| XLogP | 3.98 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|