C29H29F2N3O3 — CID 139552167
3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-4-methyl-1-(3-methylbenzimidazol-5-yl)pyridin-2-one (PubChem CID 139552167) has the molecular formula C29H29F2N3O3 and a molecular weight of 505.57 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-4-methyl-1-(3-methylbenzimidazol-5-yl)pyridin-2-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-4-methyl-1-(3-methylbenzimidazol-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 139552167 |
| Molecular Formula | C29H29F2N3O3 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-4-methyl-1-(3-methylbenzimidazol-5-yl)pyridin-2-one |
| SMILES | CC/C=C(/C=C\c1cn(-c2ccc3ncn(C)c3c2)c(=O)c(-c2ccc(OC(F)F)cc2)c1C)OCC |
| InChI | InChI=1S/C29H29F2N3O3/c1-5-7-23(36-6-2)12-10-21-17-34(22-11-15-25-26(16-22)33(4)18-32-25)28(35)27(19(21)3)20-8-13-24(14-9-20)37-29(30)31/h7-18,29H,5-6H2,1-4H3/b12-10-,23-7- |
| InChIKey | FRKNEOYRRGIMSU-JRKJYYLLSA-N |
| XLogP | 6.64 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|