C28H29F2NO4 — CID 139552150
3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-1-(4-methoxyphenyl)-4-methylpyridin-2-one (PubChem CID 139552150) has the molecular formula C28H29F2NO4 and a molecular weight of 481.54 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-1-(4-methoxyphenyl)-4-methylpyridin-2-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-1-(4-methoxyphenyl)-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 139552150 |
| Molecular Formula | C28H29F2NO4 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-5-[(1Z,3Z)-3-ethoxyhexa-1,3-dienyl]-1-(4-methoxyphenyl)-4-methylpyridin-2-one |
| SMILES | CC/C=C(/C=C\c1cn(-c2ccc(OC)cc2)c(=O)c(-c2ccc(OC(F)F)cc2)c1C)OCC |
| InChI | InChI=1S/C28H29F2NO4/c1-5-7-24(34-6-2)13-10-21-18-31(22-11-16-23(33-4)17-12-22)27(32)26(19(21)3)20-8-14-25(15-9-20)35-28(29)30/h7-18,28H,5-6H2,1-4H3/b13-10-,24-7- |
| InChIKey | RTWHIWKQUOIHQE-GSAGFOKXSA-N |
| XLogP | 6.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|