C21H16Cl2N2O5 — CID 163388151
2-(3-chloro-4-nitrophenyl)-5-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid (PubChem CID 163388151) has the molecular formula C21H16Cl2N2O5 and a molecular weight of 447.27 g/mol. Its IUPAC name is 2-(3-chloro-4-nitrophenyl)-5-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid.
| Compound Name | 2-(3-chloro-4-nitrophenyl)-5-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163388151 |
| Molecular Formula | C21H16Cl2N2O5 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-(3-chloro-4-nitrophenyl)-5-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid |
| SMILES | CCn1c(C)c(-c2ccc(Cl)cc2)c(=O)c(C(=O)O)c1-c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5/c1-3-24-11(2)17(12-4-7-14(22)8-5-12)20(26)18(21(27)28)19(24)13-6-9-16(25(29)30)15(23)10-13/h4-10H,3H2,1-2H3,(H,27,28) |
| InChIKey | GLDXJBNAIDPOCD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|