C25H34BrF2N3O5 — CID 163388526
tert-butyl (5S)-5-[2-[[2-amino-4-bromo-6-(difluoromethyl)-3-methylphenyl]methylideneamino]-3-ethoxy-3-oxopropanoyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 163388526) has the molecular formula C25H34BrF2N3O5 and a molecular weight of 574.46 g/mol. Its IUPAC name is tert-butyl (5S)-5-[2-[[2-amino-4-bromo-6-(difluoromethyl)-3-methylphenyl]methylideneamino]-3-ethoxy-3-oxopropanoyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[2-[[2-amino-4-bromo-6-(difluoromethyl)-3-methylphenyl]methylideneamino]-3-ethoxy-3-oxopropanoyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163388526 |
| Molecular Formula | C25H34BrF2N3O5 |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | tert-butyl (5S)-5-[2-[[2-amino-4-bromo-6-(difluoromethyl)-3-methylphenyl]methylideneamino]-3-ethoxy-3-oxopropanoyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(/N=C/c1c(C(F)F)cc(Br)c(C)c1N)C(=O)[C@@H]1CCC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34BrF2N3O5/c1-8-35-22(33)19(30-12-15-14(21(27)28)11-16(26)13(2)18(15)29)20(32)17-9-10-25(6,7)31(17)23(34)36-24(3,4)5/h11-12,17,19,21H,8-10,29H2,1-7H3/b30-12+/t17-,19?/m0/s1 |
| InChIKey | VSMOCLVLYCKXTB-PPWCYGFKSA-N |
| XLogP | 5.38 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|