C9H16N2 — CID 163390397
8-methyl-6,8-diazatricyclo[4.4.0.02,4]decane (PubChem CID 163390397) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 8-methyl-6,8-diazatricyclo[4.4.0.02,4]decane.
| Compound Name | 8-methyl-6,8-diazatricyclo[4.4.0.02,4]decane |
|---|---|
| PubChem CID | 163390397 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 8-methyl-6,8-diazatricyclo[4.4.0.02,4]decane |
| SMILES | CN1CCC2C3CC3CN2C1 |
| InChI | InChI=1S/C9H16N2/c1-10-3-2-9-8-4-7(8)5-11(9)6-10/h7-9H,2-6H2,1H3 |
| InChIKey | ABSVDEQMJCCZKR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |