C14H14F2N2O3 — CID 163394305
4-[(3aR,7aS)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-3-fluorobenzoic acid (PubChem CID 163394305) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is 4-[(3aR,7aS)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-3-fluorobenzoic acid.
| Compound Name | 4-[(3aR,7aS)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 163394305 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[(3aR,7aS)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(N2C[C@H]3CNCC[C@@]3(F)C2=O)c(F)c1 |
| InChI | InChI=1S/C14H14F2N2O3/c15-10-5-8(12(19)20)1-2-11(10)18-7-9-6-17-4-3-14(9,16)13(18)21/h1-2,5,9,17H,3-4,6-7H2,(H,19,20)/t9-,14+/m1/s1 |
| InChIKey | XMCJBSISCMTITF-OTYXRUKQSA-N |
| XLogP | 1.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |