About methylcyclohexane;naphthalen-1-ylmethyl formate
methylcyclohexane;naphthalen-1-ylmethyl formate (PubChem CID 163395857) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is methylcyclohexane;naphthalen-1-ylmethyl formate.
Molecular Properties
| Compound Name | methylcyclohexane;naphthalen-1-ylmethyl formate |
| PubChem CID | 163395857 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | methylcyclohexane;naphthalen-1-ylmethyl formate |
| SMILES | CC1CCCCC1.O=COCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10O2.C7H14/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11;1-7-5-3-2-4-6-7/h1-7,9H,8H2;7H,2-6H2,1H3 |
| InChIKey | YZSMOUPILUDSJP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methylcyclohexane;naphthalen-1-ylmethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;naphthalen-1-ylmethyl formate?
The IUPAC name of methylcyclohexane;naphthalen-1-ylmethyl formate (CID 163395857) is methylcyclohexane;naphthalen-1-ylmethyl formate.
What is the SMILES notation for methylcyclohexane;naphthalen-1-ylmethyl formate?
The canonical SMILES for methylcyclohexane;naphthalen-1-ylmethyl formate is CC1CCCCC1.O=COCc1cccc2ccccc12.
What is the InChIKey of methylcyclohexane;naphthalen-1-ylmethyl formate?
The InChIKey is YZSMOUPILUDSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C7H14/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11;1-7-5-3-2-4-6-7/h1-7,9H,8H2;7H,2-6H2,1H3.
What are the key properties of methylcyclohexane;naphthalen-1-ylmethyl formate?
methylcyclohexane;naphthalen-1-ylmethyl formate has a molecular weight of 284.40 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;naphthalen-1-ylmethyl formate is sourced from PubChem (CID 163395857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).