C25H29N3O2 — CID 163397668
2-(2,4-dimethyl-6-methylidenecyclohexyl)-N-[2-[(3-hydroxyphenyl)methyl]-3H-benzimidazol-5-yl]acetamide (PubChem CID 163397668) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-methylidenecyclohexyl)-N-[2-[(3-hydroxyphenyl)methyl]-3H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-(2,4-dimethyl-6-methylidenecyclohexyl)-N-[2-[(3-hydroxyphenyl)methyl]-3H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 163397668 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-(2,4-dimethyl-6-methylidenecyclohexyl)-N-[2-[(3-hydroxyphenyl)methyl]-3H-benzimidazol-5-yl]acetamide |
| SMILES | C=C1CC(C)CC(C)C1CC(=O)Nc1ccc2nc(Cc3cccc(O)c3)[nH]c2c1 |
| InChI | InChI=1S/C25H29N3O2/c1-15-9-16(2)21(17(3)10-15)14-25(30)26-19-7-8-22-23(13-19)28-24(27-22)12-18-5-4-6-20(29)11-18/h4-8,11,13,15,17,21,29H,2,9-10,12,14H2,1,3H3,(H,26,30)(H,27,28) |
| InChIKey | UVRDPFLKTGMRHM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|