About 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid
5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 163398839) has the molecular formula C18H16ClN3O4
and a molecular weight of 373.80 g/mol. Its IUPAC name is 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 163398839 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(NCC1=NOC(Cc2ccccc2)(C(=O)O)C1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C18H16ClN3O4/c19-15-8-4-7-14(21-15)16(23)20-11-13-10-18(17(24)25,26-22-13)9-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,23)(H,24,25) |
| InChIKey | IVGPILKBDUBOIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid (CID 163398839) is 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid is O=C(NCC1=NOC(Cc2ccccc2)(C(=O)O)C1)c1cccc(Cl)n1.
What is the InChIKey of 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is IVGPILKBDUBOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O4/c19-15-8-4-7-14(21-15)16(23)20-11-13-10-18(17(24)25,26-22-13)9-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,23)(H,24,25).
What are the key properties of 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid?
5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 373.80 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-[[(6-chloropyridine-2-carbonyl)amino]methyl]-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 163398839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).