C10H10N4OS — CID 163400924
N-[[5-(4-methyl-1,3-thiazol-5-yl)pyrazin-2-yl]methyl]formamide (PubChem CID 163400924) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is N-[[5-(4-methyl-1,3-thiazol-5-yl)pyrazin-2-yl]methyl]formamide.
| Compound Name | N-[[5-(4-methyl-1,3-thiazol-5-yl)pyrazin-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 163400924 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-[[5-(4-methyl-1,3-thiazol-5-yl)pyrazin-2-yl]methyl]formamide |
| SMILES | Cc1ncsc1-c1cnc(CNC=O)cn1 |
| InChI | InChI=1S/C10H10N4OS/c1-7-10(16-6-14-7)9-4-12-8(3-13-9)2-11-5-15/h3-6H,2H2,1H3,(H,11,15) |
| InChIKey | YBTUCLAYFVIKMS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|