C17H26N4O — CID 163401330
2-[(1Z)-1,4,4-triamino-3-[butyl(prop-2-enyl)amino]buta-1,3-dienyl]phenol (PubChem CID 163401330) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[butyl(prop-2-enyl)amino]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[butyl(prop-2-enyl)amino]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 163401330 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[butyl(prop-2-enyl)amino]buta-1,3-dienyl]phenol |
| SMILES | C=CCN(CCCC)C(/C=C(\N)c1ccccc1O)=C(N)N |
| InChI | InChI=1S/C17H26N4O/c1-3-5-11-21(10-4-2)15(17(19)20)12-14(18)13-8-6-7-9-16(13)22/h4,6-9,12,22H,2-3,5,10-11,18-20H2,1H3/b14-12- |
| InChIKey | JWYAATVMGDNRRH-OWBHPGMISA-N |
| XLogP | 2.07 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|