About N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine
N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine (PubChem CID 163401723) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine |
| PubChem CID | 163401723 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine |
| SMILES | CCCCC[C@H]1[C@@H](CN(C)CCC)OCCN1C |
| InChI | InChI=1S/C15H32N2O/c1-5-7-8-9-14-15(13-16(3)10-6-2)18-12-11-17(14)4/h14-15H,5-13H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | UIJQFOAOZXROMN-LSDHHAIUSA-N |
| XLogP | 2.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine?
The IUPAC name of N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine (CID 163401723) is N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine.
What is the SMILES notation for N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine?
The canonical SMILES for N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine is CCCCC[C@H]1[C@@H](CN(C)CCC)OCCN1C.
What is the InChIKey of N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine?
The InChIKey is UIJQFOAOZXROMN-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H32N2O/c1-5-7-8-9-14-15(13-16(3)10-6-2)18-12-11-17(14)4/h14-15H,5-13H2,1-4H3/t14-,15+/m0/s1.
What are the key properties of N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine?
N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine has a molecular weight of 256.43 g/mol, XLogP of 2.61, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[[(2R,3S)-4-methyl-3-pentylmorpholin-2-yl]methyl]propan-1-amine is sourced from PubChem (CID 163401723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).