C24H25ClN8 — CID 163404114
2-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine (PubChem CID 163404114) has the molecular formula C24H25ClN8 and a molecular weight of 460.97 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163404114 |
| Molecular Formula | C24H25ClN8 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cccc2c(Nc3ccnc(Nc4ccc(N5CCN(C)CC5)c(Cl)c4)n3)cnnc12 |
| InChI | InChI=1S/C24H25ClN8/c1-16-4-3-5-18-20(15-27-31-23(16)18)29-22-8-9-26-24(30-22)28-17-6-7-21(19(25)14-17)33-12-10-32(2)11-13-33/h3-9,14-15H,10-13H2,1-2H3,(H2,26,28,29,30,31) |
| InChIKey | OOTWDKDLIQMZDL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|