C50H56F2N2S4 — CID 163404647
2,7-bis(4-butyl-5-thiophen-2-ylthiophen-2-yl)-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole (PubChem CID 163404647) has the molecular formula C50H56F2N2S4 and a molecular weight of 851.28 g/mol. Its IUPAC name is 2,7-bis(4-butyl-5-thiophen-2-ylthiophen-2-yl)-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole.
| Compound Name | 2,7-bis(4-butyl-5-thiophen-2-ylthiophen-2-yl)-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole |
|---|---|
| PubChem CID | 163404647 |
| Molecular Formula | C50H56F2N2S4 |
| Molecular Weight | 851.28 g/mol |
| Exact Mass | 850.33 |
| IUPAC Name | 2,7-bis(4-butyl-5-thiophen-2-ylthiophen-2-yl)-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole |
| SMILES | CCCCCCn1c2cc(-c3cc(CCCC)c(-c4cccs4)s3)c(F)cc2c2c1c1cc(F)c(-c3cc(CCCC)c(-c4cccs4)s3)cc1n2CCCCCC |
| InChI | InChI=1S/C50H56F2N2S4/c1-5-9-13-15-23-53-41-31-35(45-27-33(19-11-7-3)49(57-45)43-21-17-25-55-43)39(51)29-37(41)48-47(53)38-30-40(52)36(32-42(38)54(48)24-16-14-10-6-2)46-28-34(20-12-8-4)50(58-46)44-22-18-26-56-44/h17-18,21-22,25-32H,5-16,19-20,23-24H2,1-4H3 |
| InChIKey | JCPOSHSSNSTLKE-UHFFFAOYSA-N |
| XLogP | 17.79 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.28 |
| LogP ≤ 5 | 17.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|