About disodium;propa-1,2-diene-1,1-diolate
disodium;propa-1,2-diene-1,1-diolate (PubChem CID 163406175) has the molecular formula C3H2Na2O2
and a molecular weight of 116.03 g/mol. Its IUPAC name is disodium;propa-1,2-diene-1,1-diolate.
Molecular Properties
| Compound Name | disodium;propa-1,2-diene-1,1-diolate |
| PubChem CID | 163406175 |
| Molecular Formula | C3H2Na2O2 |
| Molecular Weight | 116.03 g/mol |
| Exact Mass | 115.99 |
| IUPAC Name | disodium;propa-1,2-diene-1,1-diolate |
| SMILES | C=C=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H4O2.2Na/c1-2-3(4)5;;/h4-5H,1H2;;/q;2*+1/p-2 |
| InChIKey | OCKMWFYDTZCTFJ-UHFFFAOYSA-L |
| XLogP | -7.66 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.03 |
| LogP ≤ 5 | -7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze disodium;propa-1,2-diene-1,1-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;propa-1,2-diene-1,1-diolate?
The IUPAC name of disodium;propa-1,2-diene-1,1-diolate (CID 163406175) is disodium;propa-1,2-diene-1,1-diolate.
What is the SMILES notation for disodium;propa-1,2-diene-1,1-diolate?
The canonical SMILES for disodium;propa-1,2-diene-1,1-diolate is C=C=C([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;propa-1,2-diene-1,1-diolate?
The InChIKey is OCKMWFYDTZCTFJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O2.2Na/c1-2-3(4)5;;/h4-5H,1H2;;/q;2*+1/p-2.
What are the key properties of disodium;propa-1,2-diene-1,1-diolate?
disodium;propa-1,2-diene-1,1-diolate has a molecular weight of 116.03 g/mol, XLogP of -7.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;propa-1,2-diene-1,1-diolate is sourced from PubChem (CID 163406175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).