C3H2Na2O2 — CID 163406175
disodium;propa-1,2-diene-1,1-diolate (PubChem CID 163406175) has the molecular formula C3H2Na2O2 and a molecular weight of 116.03 g/mol. Its IUPAC name is disodium;propa-1,2-diene-1,1-diolate.
| Compound Name | disodium;propa-1,2-diene-1,1-diolate |
|---|---|
| PubChem CID | 163406175 |
| Molecular Formula | C3H2Na2O2 |
| Molecular Weight | 116.03 g/mol |
| Exact Mass | 115.99 |
| IUPAC Name | disodium;propa-1,2-diene-1,1-diolate |
| SMILES | C=C=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H4O2.2Na/c1-2-3(4)5;;/h4-5H,1H2;;/q;2*+1/p-2 |
| InChIKey | OCKMWFYDTZCTFJ-UHFFFAOYSA-L |
| XLogP | -7.66 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.03 |
| LogP ≤ 5 | -7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|