About N-hydroxybuta-2,3-dien-2-amine oxide
N-hydroxybuta-2,3-dien-2-amine oxide (PubChem CID 163570462) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is N-hydroxybuta-2,3-dien-2-amine oxide.
Molecular Properties
| Compound Name | N-hydroxybuta-2,3-dien-2-amine oxide |
| PubChem CID | 163570462 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | N-hydroxybuta-2,3-dien-2-amine oxide |
| SMILES | C=C=C(C)[NH+]([O-])O |
| InChI | InChI=1S/C4H7NO2/c1-3-4(2)5(6)7/h5-6H,1H2,2H3 |
| InChIKey | FYWXOOCCZOPPJL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxybuta-2,3-dien-2-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxybuta-2,3-dien-2-amine oxide?
The IUPAC name of N-hydroxybuta-2,3-dien-2-amine oxide (CID 163570462) is N-hydroxybuta-2,3-dien-2-amine oxide.
What is the SMILES notation for N-hydroxybuta-2,3-dien-2-amine oxide?
The canonical SMILES for N-hydroxybuta-2,3-dien-2-amine oxide is C=C=C(C)[NH+]([O-])O.
What is the InChIKey of N-hydroxybuta-2,3-dien-2-amine oxide?
The InChIKey is FYWXOOCCZOPPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-3-4(2)5(6)7/h5-6H,1H2,2H3.
What are the key properties of N-hydroxybuta-2,3-dien-2-amine oxide?
N-hydroxybuta-2,3-dien-2-amine oxide has a molecular weight of 101.10 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxybuta-2,3-dien-2-amine oxide is sourced from PubChem (CID 163570462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).