C7H8 — CID 91384433
3-methylhexa-1,2-dien-4-yne (PubChem CID 91384433) has the molecular formula C7H8 and a molecular weight of 92.14 g/mol. Its IUPAC name is 3-methylhexa-1,2-dien-4-yne.
| Compound Name | 3-methylhexa-1,2-dien-4-yne |
|---|---|
| PubChem CID | 91384433 |
| Molecular Formula | C7H8 |
| Molecular Weight | 92.14 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | 3-methylhexa-1,2-dien-4-yne |
| SMILES | C=C=C(C)C#CC |
| InChI | InChI=1S/C7H8/c1-4-6-7(3)5-2/h2H2,1,3H3 |
| InChIKey | LOAADTMZHSLFAF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.14 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|