C8H14O — CID 130874615
(2R,3S)-3,4-dimethylhexa-4,5-dien-2-ol (PubChem CID 130874615) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2R,3S)-3,4-dimethylhexa-4,5-dien-2-ol.
| Compound Name | (2R,3S)-3,4-dimethylhexa-4,5-dien-2-ol |
|---|---|
| PubChem CID | 130874615 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2R,3S)-3,4-dimethylhexa-4,5-dien-2-ol |
| SMILES | C=C=C(C)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C8H14O/c1-5-6(2)7(3)8(4)9/h7-9H,1H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | DRZQPXCUOYLOEX-JGVFFNPUSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |