About 1-buta-2,3-dien-2-yloxyethanol
1-buta-2,3-dien-2-yloxyethanol (PubChem CID 130286219) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 1-buta-2,3-dien-2-yloxyethanol.
Molecular Properties
| Compound Name | 1-buta-2,3-dien-2-yloxyethanol |
| PubChem CID | 130286219 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 1-buta-2,3-dien-2-yloxyethanol |
| SMILES | C=C=C(C)OC(C)O |
| InChI | InChI=1S/C6H10O2/c1-4-5(2)8-6(3)7/h6-7H,1H2,2-3H3 |
| InChIKey | YJZRJLXQFHIITI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-2,3-dien-2-yloxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-2,3-dien-2-yloxyethanol?
The IUPAC name of 1-buta-2,3-dien-2-yloxyethanol (CID 130286219) is 1-buta-2,3-dien-2-yloxyethanol.
What is the SMILES notation for 1-buta-2,3-dien-2-yloxyethanol?
The canonical SMILES for 1-buta-2,3-dien-2-yloxyethanol is C=C=C(C)OC(C)O.
What is the InChIKey of 1-buta-2,3-dien-2-yloxyethanol?
The InChIKey is YJZRJLXQFHIITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-4-5(2)8-6(3)7/h6-7H,1H2,2-3H3.
What are the key properties of 1-buta-2,3-dien-2-yloxyethanol?
1-buta-2,3-dien-2-yloxyethanol has a molecular weight of 114.14 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-2,3-dien-2-yloxyethanol is sourced from PubChem (CID 130286219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).