C7H11Cl — CID 55302448
5-chloro-3,4-dimethylpenta-1,2-diene (PubChem CID 55302448) has the molecular formula C7H11Cl and a molecular weight of 130.62 g/mol. Its IUPAC name is 5-chloro-3,4-dimethylpenta-1,2-diene.
| Compound Name | 5-chloro-3,4-dimethylpenta-1,2-diene |
|---|---|
| PubChem CID | 55302448 |
| Molecular Formula | C7H11Cl |
| Molecular Weight | 130.62 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 5-chloro-3,4-dimethylpenta-1,2-diene |
| SMILES | C=C=C(C)C(C)CCl |
| InChI | InChI=1S/C7H11Cl/c1-4-6(2)7(3)5-8/h7H,1,5H2,2-3H3 |
| InChIKey | QKVMAYATFZFJLU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|