C16H17ClF3NO — CID 163407566
2-[3-methyl-4-[4-(trifluoromethyl)phenyl]phenoxy]ethanamine;hydrochloride (PubChem CID 163407566) has the molecular formula C16H17ClF3NO and a molecular weight of 331.77 g/mol. Its IUPAC name is 2-[3-methyl-4-[4-(trifluoromethyl)phenyl]phenoxy]ethanamine;hydrochloride.
| Compound Name | 2-[3-methyl-4-[4-(trifluoromethyl)phenyl]phenoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 163407566 |
| Molecular Formula | C16H17ClF3NO |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[3-methyl-4-[4-(trifluoromethyl)phenyl]phenoxy]ethanamine;hydrochloride |
| SMILES | Cc1cc(OCCN)ccc1-c1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C16H16F3NO.ClH/c1-11-10-14(21-9-8-20)6-7-15(11)12-2-4-13(5-3-12)16(17,18)19;/h2-7,10H,8-9,20H2,1H3;1H |
| InChIKey | QYVHDQNBQLCZOA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |