C36H39N9O5 — CID 163407912
tert-butyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate (PubChem CID 163407912) has the molecular formula C36H39N9O5 and a molecular weight of 677.77 g/mol. Its IUPAC name is tert-butyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163407912 |
| Molecular Formula | C36H39N9O5 |
| Molecular Weight | 677.77 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | tert-butyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ccc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4ccc5c(n4)N(CCC/C=C\C6)C(=O)CO5)ccc32)CC1 |
| InChI | InChI=1S/C36H39N9O5/c1-36(2,3)50-35(48)41-17-13-25(14-18-41)42-19-12-23-20-24(8-9-27(23)42)38-34-37-21-26-31(40-34)45-29-11-10-28-32(39-29)43(30(46)22-49-28)15-6-4-5-7-16-44(45)33(26)47/h5,7-12,19-21,25H,4,6,13-18,22H2,1-3H3,(H,37,38,40)/b7-5- |
| InChIKey | HTERJHNILGYBON-ALCCZGGFSA-N |
| XLogP | 5.32 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|