6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid

C12H6ClNO3S — CID 163409236

IUPAC6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid
SMILESO=C(O)c1cc2c([nH]c3ccc(Cl)cc32)c(=O)s1
InChIInChI=1S/C12H6ClNO3S/c13-5-1-2-8-6(3-5)7-4-9(11(15)16)18-12(17)10(7)14-8/h1-4,14H,(H,15,16)
InChIKeyKEJMJNDVEUHOIP-UHFFFAOYSA-N
MW279.70 g/mol
LogP3.09
Rot. Bonds1

About 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid

6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid (PubChem CID 163409236) has the molecular formula C12H6ClNO3S and a molecular weight of 279.70 g/mol. Its IUPAC name is 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid.

Molecular Properties

Compound Name6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid
PubChem CID163409236
Molecular FormulaC12H6ClNO3S
Molecular Weight279.70 g/mol
Exact Mass278.98
IUPAC Name6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid
SMILESO=C(O)c1cc2c([nH]c3ccc(Cl)cc32)c(=O)s1
InChIInChI=1S/C12H6ClNO3S/c13-5-1-2-8-6(3-5)7-4-9(11(15)16)18-12(17)10(7)14-8/h1-4,14H,(H,15,16)
InChIKeyKEJMJNDVEUHOIP-UHFFFAOYSA-N
XLogP3.09
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.70
LogP ≤ 53.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid?
The IUPAC name of 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid (CID 163409236) is 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid.
What is the SMILES notation for 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid?
The canonical SMILES for 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid is O=C(O)c1cc2c([nH]c3ccc(Cl)cc32)c(=O)s1.
What is the InChIKey of 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid?
The InChIKey is KEJMJNDVEUHOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClNO3S/c13-5-1-2-8-6(3-5)7-4-9(11(15)16)18-12(17)10(7)14-8/h1-4,14H,(H,15,16).
What are the key properties of 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid?
6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid has a molecular weight of 279.70 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid is sourced from PubChem (CID 163409236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).