C12H6ClNO3S — CID 163409236
6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid (PubChem CID 163409236) has the molecular formula C12H6ClNO3S and a molecular weight of 279.70 g/mol. Its IUPAC name is 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid.
| Compound Name | 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 163409236 |
| Molecular Formula | C12H6ClNO3S |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 6-chloro-1-oxo-9H-thiopyrano[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]c3ccc(Cl)cc32)c(=O)s1 |
| InChI | InChI=1S/C12H6ClNO3S/c13-5-1-2-8-6(3-5)7-4-9(11(15)16)18-12(17)10(7)14-8/h1-4,14H,(H,15,16) |
| InChIKey | KEJMJNDVEUHOIP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |