About 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid
5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid (PubChem CID 82389520) has the molecular formula C11H6FNO2S
and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid |
| PubChem CID | 82389520 |
| Molecular Formula | C11H6FNO2S |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2[nH]c3c(F)cccc3c2s1 |
| InChI | InChI=1S/C11H6FNO2S/c12-6-3-1-2-5-9(6)13-7-4-8(11(14)15)16-10(5)7/h1-4,13H,(H,14,15) |
| InChIKey | AMYRPTZYKYIANQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid (CID 82389520) is 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid is O=C(O)c1cc2[nH]c3c(F)cccc3c2s1.
What is the InChIKey of 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid?
The InChIKey is AMYRPTZYKYIANQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FNO2S/c12-6-3-1-2-5-9(6)13-7-4-8(11(14)15)16-10(5)7/h1-4,13H,(H,14,15).
What are the key properties of 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid?
5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid has a molecular weight of 235.24 g/mol, XLogP of 3.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4H-thieno[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 82389520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).