C15H19BrFNO — CID 163411039
(2R,3E)-N-(4-bromocyclohexa-1,3-dien-1-yl)-6-fluoro-2-methylocta-3,7-dienamide (PubChem CID 163411039) has the molecular formula C15H19BrFNO and a molecular weight of 328.23 g/mol. Its IUPAC name is (2R,3E)-N-(4-bromocyclohexa-1,3-dien-1-yl)-6-fluoro-2-methylocta-3,7-dienamide.
| Compound Name | (2R,3E)-N-(4-bromocyclohexa-1,3-dien-1-yl)-6-fluoro-2-methylocta-3,7-dienamide |
|---|---|
| PubChem CID | 163411039 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (2R,3E)-N-(4-bromocyclohexa-1,3-dien-1-yl)-6-fluoro-2-methylocta-3,7-dienamide |
| SMILES | C=CC(F)C/C=C/[C@@H](C)C(=O)NC1=CC=C(Br)CC1 |
| InChI | InChI=1S/C15H19BrFNO/c1-3-13(17)6-4-5-11(2)15(19)18-14-9-7-12(16)8-10-14/h3-5,7,9,11,13H,1,6,8,10H2,2H3,(H,18,19)/b5-4+/t11-,13?/m1/s1 |
| InChIKey | AAMYDLDNCPFCKY-WDWRJZHLSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|