C8H9BrFNO — CID 143838666
N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 143838666) has the molecular formula C8H9BrFNO and a molecular weight of 234.07 g/mol. Its IUPAC name is N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 143838666 |
| Molecular Formula | C8H9BrFNO |
| Molecular Weight | 234.07 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=C(Br)CCC(F)=C1 |
| InChI | InChI=1S/C8H9BrFNO/c1-5(12)11-8-4-6(10)2-3-7(8)9/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | BOQHAUUNFVEEIC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |