C16H13F3N2O2 — CID 163413507
6-(3-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 163413507) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 6-(3-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(3-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163413507 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-(3-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | C=CCc1cccc(Nc2ccc(C(=O)O)c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-2-4-10-5-3-6-11(9-10)20-13-8-7-12(15(22)23)14(21-13)16(17,18)19/h2-3,5-9H,1,4H2,(H,20,21)(H,22,23) |
| InChIKey | ACMCQLLJQGJQEE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|