C18H16F3NO — CID 132601511
N-benzyl-2-prop-2-enyl-5-(trifluoromethyl)benzamide (PubChem CID 132601511) has the molecular formula C18H16F3NO and a molecular weight of 319.33 g/mol. Its IUPAC name is N-benzyl-2-prop-2-enyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-benzyl-2-prop-2-enyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 132601511 |
| Molecular Formula | C18H16F3NO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-benzyl-2-prop-2-enyl-5-(trifluoromethyl)benzamide |
| SMILES | C=CCc1ccc(C(F)(F)F)cc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO/c1-2-6-14-9-10-15(18(19,20)21)11-16(14)17(23)22-12-13-7-4-3-5-8-13/h2-5,7-11H,1,6,12H2,(H,22,23) |
| InChIKey | QCPGLEGXDCUXAQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|