C35H57NO11 — CID 163416792
(4R)-8-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]-4-[[(3S)-2-methyl-4-oxohexan-3-yl]carbamoyl]-6-oxooctanoic acid (PubChem CID 163416792) has the molecular formula C35H57NO11 and a molecular weight of 667.84 g/mol. Its IUPAC name is (4R)-8-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]-4-[[(3S)-2-methyl-4-oxohexan-3-yl]carbamoyl]-6-oxooctanoic acid.
| Compound Name | (4R)-8-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]-4-[[(3S)-2-methyl-4-oxohexan-3-yl]carbamoyl]-6-oxooctanoic acid |
|---|---|
| PubChem CID | 163416792 |
| Molecular Formula | C35H57NO11 |
| Molecular Weight | 667.84 g/mol |
| Exact Mass | 667.39 |
| IUPAC Name | (4R)-8-[2-[2-[2-(5-cyclooct-2-yn-1-yloxy-4-oxopentoxy)ethoxy]ethoxy]ethoxy]-4-[[(3S)-2-methyl-4-oxohexan-3-yl]carbamoyl]-6-oxooctanoic acid |
| SMILES | CCC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)CC(=O)CCOCCOCCOCCOCCCC(=O)COC1C#CCCCCC1)C(C)C |
| InChI | InChI=1S/C35H57NO11/c1-4-32(39)34(27(2)3)36-35(42)28(14-15-33(40)41)25-29(37)16-18-44-20-22-46-24-23-45-21-19-43-17-10-11-30(38)26-47-31-12-8-6-5-7-9-13-31/h27-28,31,34H,4-8,10-12,14-26H2,1-3H3,(H,36,42)(H,40,41)/t28-,31?,34+/m1/s1 |
| InChIKey | ZKFKRPYQSNXDFI-IGFDWXJXSA-N |
| XLogP | 3.70 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|