C20H35NO6 — CID 164777208
2-cyclooct-2-yn-1-yloxy-N-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 164777208) has the molecular formula C20H35NO6 and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-cyclooct-2-yn-1-yloxy-N-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-cyclooct-2-yn-1-yloxy-N-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 164777208 |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-cyclooct-2-yn-1-yloxy-N-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CCOCCOCCOCCOCCNC(=O)COC1C#CCCCCC1 |
| InChI | InChI=1S/C20H35NO6/c1-2-23-12-13-25-16-17-26-15-14-24-11-10-21-20(22)18-27-19-8-6-4-3-5-7-9-19/h19H,2-6,8,10-18H2,1H3,(H,21,22) |
| InChIKey | SZHWLBRZDRUVME-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|