C26H37F3N2O7 — CID 159935946
2-cyclooct-2-yn-1-yloxyacetic acid;N-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 159935946) has the molecular formula C26H37F3N2O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-cyclooct-2-yn-1-yloxyacetic acid;N-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | 2-cyclooct-2-yn-1-yloxyacetic acid;N-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 159935946 |
| Molecular Formula | C26H37F3N2O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 2-cyclooct-2-yn-1-yloxyacetic acid;N-[2-[2-[(2-cyclooct-2-yn-1-yloxyacetyl)amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(COC1C#CCCCCC1)NCCOCCNC(=O)C(F)(F)F.O=C(O)COC1C#CCCCCC1 |
| InChI | InChI=1S/C16H23F3N2O4.C10H14O3/c17-16(18,19)15(23)21-9-11-24-10-8-20-14(22)12-25-13-6-4-2-1-3-5-7-13;11-10(12)8-13-9-6-4-2-1-3-5-7-9/h13H,1-4,6,8-12H2,(H,20,22)(H,21,23);9H,1-4,6,8H2,(H,11,12) |
| InChIKey | OAGDEOCUZCWNKN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|